C14H22N2O — CID 89214945
(2E,3Z)-5-amino-N-cyclohexyl-2-ethylidenehexa-3,5-dienamide (PubChem CID 89214945) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is (2E,3Z)-5-amino-N-cyclohexyl-2-ethylidenehexa-3,5-dienamide.
| Compound Name | (2E,3Z)-5-amino-N-cyclohexyl-2-ethylidenehexa-3,5-dienamide |
|---|---|
| PubChem CID | 89214945 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | (2E,3Z)-5-amino-N-cyclohexyl-2-ethylidenehexa-3,5-dienamide |
| SMILES | C=C(N)/C=C\C(=C/C)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C14H22N2O/c1-3-12(10-9-11(2)15)14(17)16-13-7-5-4-6-8-13/h3,9-10,13H,2,4-8,15H2,1H3,(H,16,17)/b10-9-,12-3+ |
| InChIKey | SNJFGJBZSNSJON-FKFYTSLUSA-N |
| XLogP | 2.41 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|