C12H20FNO — CID 89214988
4-[(2E,4E)-4-fluorohexa-2,4-dien-2-yl]-2,6-dimethylmorpholine (PubChem CID 89214988) has the molecular formula C12H20FNO and a molecular weight of 213.30 g/mol. Its IUPAC name is 4-[(2E,4E)-4-fluorohexa-2,4-dien-2-yl]-2,6-dimethylmorpholine.
| Compound Name | 4-[(2E,4E)-4-fluorohexa-2,4-dien-2-yl]-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 89214988 |
| Molecular Formula | C12H20FNO |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 4-[(2E,4E)-4-fluorohexa-2,4-dien-2-yl]-2,6-dimethylmorpholine |
| SMILES | C/C=C(F)\C=C(/C)N1CC(C)OC(C)C1 |
| InChI | InChI=1S/C12H20FNO/c1-5-12(13)6-9(2)14-7-10(3)15-11(4)8-14/h5-6,10-11H,7-8H2,1-4H3/b9-6+,12-5+ |
| InChIKey | GAMSYHKOXFJOTC-CQKKQSJTSA-N |
| XLogP | 2.87 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|