C10H12FNO — CID 89215020
N-(2-fluoro-2,3,5,6-tetrahydro-1H-inden-5-yl)formamide (PubChem CID 89215020) has the molecular formula C10H12FNO and a molecular weight of 181.21 g/mol. Its IUPAC name is N-(2-fluoro-2,3,5,6-tetrahydro-1H-inden-5-yl)formamide.
| Compound Name | N-(2-fluoro-2,3,5,6-tetrahydro-1H-inden-5-yl)formamide |
|---|---|
| PubChem CID | 89215020 |
| Molecular Formula | C10H12FNO |
| Molecular Weight | 181.21 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | N-(2-fluoro-2,3,5,6-tetrahydro-1H-inden-5-yl)formamide |
| SMILES | O=CNC1C=C2CC(F)CC2=CC1 |
| InChI | InChI=1S/C10H12FNO/c11-9-3-7-1-2-10(12-6-13)5-8(7)4-9/h1,5-6,9-10H,2-4H2,(H,12,13) |
| InChIKey | AOJUSTXGHFWUDL-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.21 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|