C14H26N2O — CID 89215058
(2Z,4E)-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-methylhepta-2,4-dien-1-amine (PubChem CID 89215058) has the molecular formula C14H26N2O and a molecular weight of 238.37 g/mol. Its IUPAC name is (2Z,4E)-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-methylhepta-2,4-dien-1-amine.
| Compound Name | (2Z,4E)-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-methylhepta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 89215058 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | (2Z,4E)-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-methylhepta-2,4-dien-1-amine |
| SMILES | CC/C=C(C(\C)=C/CN)/N1C[C@@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C14H26N2O/c1-5-6-14(11(2)7-8-15)16-9-12(3)17-13(4)10-16/h6-7,12-13H,5,8-10,15H2,1-4H3/b11-7-,14-6+/t12-,13+ |
| InChIKey | VSEANWOLNVQRAX-WTJLXHFCSA-N |
| XLogP | 2.29 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|