C8H11F2NO — CID 89215062
N-[(4R,5E)-2,6-difluorohepta-1,5-dien-4-yl]formamide (PubChem CID 89215062) has the molecular formula C8H11F2NO and a molecular weight of 175.18 g/mol. Its IUPAC name is N-[(4R,5E)-2,6-difluorohepta-1,5-dien-4-yl]formamide.
| Compound Name | N-[(4R,5E)-2,6-difluorohepta-1,5-dien-4-yl]formamide |
|---|---|
| PubChem CID | 89215062 |
| Molecular Formula | C8H11F2NO |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | N-[(4R,5E)-2,6-difluorohepta-1,5-dien-4-yl]formamide |
| SMILES | C=C(F)C[C@H](/C=C(\C)F)NC=O |
| InChI | InChI=1S/C8H11F2NO/c1-6(9)3-8(11-5-12)4-7(2)10/h4-5,8H,1,3H2,2H3,(H,11,12)/b7-4+/t8-/m1/s1 |
| InChIKey | OPYQARVNTCFMOE-RXLGXGPVSA-N |
| XLogP | 1.85 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|