C11H16F3NO — CID 89215063
N-[(Z,2S)-6,6,6-trifluoro-2-methyl-2-prop-2-enylhex-3-enyl]formamide (PubChem CID 89215063) has the molecular formula C11H16F3NO and a molecular weight of 235.25 g/mol. Its IUPAC name is N-[(Z,2S)-6,6,6-trifluoro-2-methyl-2-prop-2-enylhex-3-enyl]formamide.
| Compound Name | N-[(Z,2S)-6,6,6-trifluoro-2-methyl-2-prop-2-enylhex-3-enyl]formamide |
|---|---|
| PubChem CID | 89215063 |
| Molecular Formula | C11H16F3NO |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | N-[(Z,2S)-6,6,6-trifluoro-2-methyl-2-prop-2-enylhex-3-enyl]formamide |
| SMILES | C=CC[C@@](C)(/C=C\CC(F)(F)F)CNC=O |
| InChI | InChI=1S/C11H16F3NO/c1-3-5-10(2,8-15-9-16)6-4-7-11(12,13)14/h3-4,6,9H,1,5,7-8H2,2H3,(H,15,16)/b6-4-/t10-/m0/s1 |
| InChIKey | BJBVOENBULYMIC-OAQKJQOQSA-N |
| XLogP | 2.82 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|