C17H29N3O — CID 89215079
5-amino-N-[(2Z,4E)-4-[ethyl(prop-2-enyl)amino]hepta-2,4,6-trienyl]pentanamide (PubChem CID 89215079) has the molecular formula C17H29N3O and a molecular weight of 291.44 g/mol. Its IUPAC name is 5-amino-N-[(2Z,4E)-4-[ethyl(prop-2-enyl)amino]hepta-2,4,6-trienyl]pentanamide.
| Compound Name | 5-amino-N-[(2Z,4E)-4-[ethyl(prop-2-enyl)amino]hepta-2,4,6-trienyl]pentanamide |
|---|---|
| PubChem CID | 89215079 |
| Molecular Formula | C17H29N3O |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.23 |
| IUPAC Name | 5-amino-N-[(2Z,4E)-4-[ethyl(prop-2-enyl)amino]hepta-2,4,6-trienyl]pentanamide |
| SMILES | C=C/C=C(\C=C/CNC(=O)CCCCN)N(CC)CC=C |
| InChI | InChI=1S/C17H29N3O/c1-4-10-16(20(6-3)15-5-2)11-9-14-19-17(21)12-7-8-13-18/h4-5,9-11H,1-2,6-8,12-15,18H2,3H3,(H,19,21)/b11-9-,16-10+ |
| InChIKey | CMFPLQPSRGUHHX-LJOSEPHYSA-N |
| XLogP | 2.37 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|