C17H30N2 — CID 89215088
(E)-1-N-[(3E,7Z)-3,7-dimethyl-6-methylideneundeca-3,7-dien-5-yl]prop-1-ene-1,2-diamine (PubChem CID 89215088) has the molecular formula C17H30N2 and a molecular weight of 262.44 g/mol. Its IUPAC name is (E)-1-N-[(3E,7Z)-3,7-dimethyl-6-methylideneundeca-3,7-dien-5-yl]prop-1-ene-1,2-diamine.
| Compound Name | (E)-1-N-[(3E,7Z)-3,7-dimethyl-6-methylideneundeca-3,7-dien-5-yl]prop-1-ene-1,2-diamine |
|---|---|
| PubChem CID | 89215088 |
| Molecular Formula | C17H30N2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.24 |
| IUPAC Name | (E)-1-N-[(3E,7Z)-3,7-dimethyl-6-methylideneundeca-3,7-dien-5-yl]prop-1-ene-1,2-diamine |
| SMILES | C=C(/C(C)=C\CCC)C(/C=C(\C)CC)N/C=C(\C)N |
| InChI | InChI=1S/C17H30N2/c1-7-9-10-14(4)16(6)17(11-13(3)8-2)19-12-15(5)18/h10-12,17,19H,6-9,18H2,1-5H3/b13-11+,14-10-,15-12+ |
| InChIKey | JDVXZFPPWYGQDE-DIMLXNTNSA-N |
| XLogP | 4.42 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|