C9H13NO2 — CID 89215094
N-[(3E,5Z)-7-methoxyhepta-1,3,5-trien-4-yl]formamide (PubChem CID 89215094) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is N-[(3E,5Z)-7-methoxyhepta-1,3,5-trien-4-yl]formamide.
| Compound Name | N-[(3E,5Z)-7-methoxyhepta-1,3,5-trien-4-yl]formamide |
|---|---|
| PubChem CID | 89215094 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | N-[(3E,5Z)-7-methoxyhepta-1,3,5-trien-4-yl]formamide |
| SMILES | C=C/C=C(\C=C/COC)NC=O |
| InChI | InChI=1S/C9H13NO2/c1-3-5-9(10-8-11)6-4-7-12-2/h3-6,8H,1,7H2,2H3,(H,10,11)/b6-4-,9-5+ |
| InChIKey | QRPCGTTUXACJPE-QUNSIMLLSA-N |
| XLogP | 1.00 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|