C14H19NO — CID 89215140
N-[(3E,5Z)-7-cyclohex-2-en-1-ylhepta-1,3,5-trien-4-yl]formamide (PubChem CID 89215140) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is N-[(3E,5Z)-7-cyclohex-2-en-1-ylhepta-1,3,5-trien-4-yl]formamide.
| Compound Name | N-[(3E,5Z)-7-cyclohex-2-en-1-ylhepta-1,3,5-trien-4-yl]formamide |
|---|---|
| PubChem CID | 89215140 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | N-[(3E,5Z)-7-cyclohex-2-en-1-ylhepta-1,3,5-trien-4-yl]formamide |
| SMILES | C=C/C=C(\C=C/CC1C=CCCC1)NC=O |
| InChI | InChI=1S/C14H19NO/c1-2-7-14(15-12-16)11-6-10-13-8-4-3-5-9-13/h2,4,6-8,11-13H,1,3,5,9-10H2,(H,15,16)/b11-6-,14-7+ |
| InChIKey | QDFYNZKPMZYXPV-DKSOOILDSA-N |
| XLogP | 3.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|