C26H29F3N4O3 — CID 89215287
3-benzyl-3-[[2-(1,3-oxazol-2-yl)ethylamino]oxymethyl]-N-[4-(trifluoromethyl)phenyl]piperidine-1-carboxamide (PubChem CID 89215287) has the molecular formula C26H29F3N4O3 and a molecular weight of 502.54 g/mol. Its IUPAC name is 3-benzyl-3-[[2-(1,3-oxazol-2-yl)ethylamino]oxymethyl]-N-[4-(trifluoromethyl)phenyl]piperidine-1-carboxamide.
| Compound Name | 3-benzyl-3-[[2-(1,3-oxazol-2-yl)ethylamino]oxymethyl]-N-[4-(trifluoromethyl)phenyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 89215287 |
| Molecular Formula | C26H29F3N4O3 |
| Molecular Weight | 502.54 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | 3-benzyl-3-[[2-(1,3-oxazol-2-yl)ethylamino]oxymethyl]-N-[4-(trifluoromethyl)phenyl]piperidine-1-carboxamide |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)N1CCCC(CONCCc2ncco2)(Cc2ccccc2)C1 |
| InChI | InChI=1S/C26H29F3N4O3/c27-26(28,29)21-7-9-22(10-8-21)32-24(34)33-15-4-12-25(18-33,17-20-5-2-1-3-6-20)19-36-31-13-11-23-30-14-16-35-23/h1-3,5-10,14,16,31H,4,11-13,15,17-19H2,(H,32,34) |
| InChIKey | YCPREJBSNBLPFF-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 79.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.54 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|