C25H27N5O2S — CID 89215394
(1S)-5-[5-(3-amino-4-propan-2-yloxyphenyl)-1,3,4-thiadiazol-2-yl]-N-(1,3-oxazol-5-ylmethyl)-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 89215394) has the molecular formula C25H27N5O2S and a molecular weight of 461.59 g/mol. Its IUPAC name is (1S)-5-[5-(3-amino-4-propan-2-yloxyphenyl)-1,3,4-thiadiazol-2-yl]-N-(1,3-oxazol-5-ylmethyl)-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | (1S)-5-[5-(3-amino-4-propan-2-yloxyphenyl)-1,3,4-thiadiazol-2-yl]-N-(1,3-oxazol-5-ylmethyl)-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 89215394 |
| Molecular Formula | C25H27N5O2S |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | (1S)-5-[5-(3-amino-4-propan-2-yloxyphenyl)-1,3,4-thiadiazol-2-yl]-N-(1,3-oxazol-5-ylmethyl)-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | CC(C)Oc1ccc(-c2nnc(-c3cccc4c3CCC[C@@H]4NCc3cnco3)s2)cc1N |
| InChI | InChI=1S/C25H27N5O2S/c1-15(2)32-23-10-9-16(11-21(23)26)24-29-30-25(33-24)20-7-3-6-19-18(20)5-4-8-22(19)28-13-17-12-27-14-31-17/h3,6-7,9-12,14-15,22,28H,4-5,8,13,26H2,1-2H3/t22-/m0/s1 |
| InChIKey | SLEPXBXRSBIXNB-QFIPXVFZSA-N |
| XLogP | 5.40 |
| TPSA | 99.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|