C22H26N4O3S2 — CID 89215396
2-(3-amino-4-propan-2-yloxyphenyl)-5-[(5R)-5-(sulfamoylamino)-5,6,7,8-tetrahydronaphthalen-1-yl]-1,3-thiazole (PubChem CID 89215396) has the molecular formula C22H26N4O3S2 and a molecular weight of 458.61 g/mol. Its IUPAC name is 2-(3-amino-4-propan-2-yloxyphenyl)-5-[(5R)-5-(sulfamoylamino)-5,6,7,8-tetrahydronaphthalen-1-yl]-1,3-thiazole.
| Compound Name | 2-(3-amino-4-propan-2-yloxyphenyl)-5-[(5R)-5-(sulfamoylamino)-5,6,7,8-tetrahydronaphthalen-1-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 89215396 |
| Molecular Formula | C22H26N4O3S2 |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | 2-(3-amino-4-propan-2-yloxyphenyl)-5-[(5R)-5-(sulfamoylamino)-5,6,7,8-tetrahydronaphthalen-1-yl]-1,3-thiazole |
| SMILES | CC(C)Oc1ccc(-c2ncc(-c3cccc4c3CCC[C@H]4NS(N)(=O)=O)s2)cc1N |
| InChI | InChI=1S/C22H26N4O3S2/c1-13(2)29-20-10-9-14(11-18(20)23)22-25-12-21(30-22)17-7-3-6-16-15(17)5-4-8-19(16)26-31(24,27)28/h3,6-7,9-13,19,26H,4-5,8,23H2,1-2H3,(H2,24,27,28)/t19-/m1/s1 |
| InChIKey | MLFWWUOHINIARL-LJQANCHMSA-N |
| XLogP | 4.02 |
| TPSA | 120.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|