C27H27N5O2S — CID 89215407
N-[(1R)-5-[5-(3-amino-4-propan-2-yloxyphenyl)-1,3,4-thiadiazol-2-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]pyridine-3-carboxamide (PubChem CID 89215407) has the molecular formula C27H27N5O2S and a molecular weight of 485.61 g/mol. Its IUPAC name is N-[(1R)-5-[5-(3-amino-4-propan-2-yloxyphenyl)-1,3,4-thiadiazol-2-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]pyridine-3-carboxamide.
| Compound Name | N-[(1R)-5-[5-(3-amino-4-propan-2-yloxyphenyl)-1,3,4-thiadiazol-2-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 89215407 |
| Molecular Formula | C27H27N5O2S |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | N-[(1R)-5-[5-(3-amino-4-propan-2-yloxyphenyl)-1,3,4-thiadiazol-2-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]pyridine-3-carboxamide |
| SMILES | CC(C)Oc1ccc(-c2nnc(-c3cccc4c3CCC[C@H]4NC(=O)c3cccnc3)s2)cc1N |
| InChI | InChI=1S/C27H27N5O2S/c1-16(2)34-24-12-11-17(14-22(24)28)26-31-32-27(35-26)21-9-3-8-20-19(21)7-4-10-23(20)30-25(33)18-6-5-13-29-15-18/h3,5-6,8-9,11-16,23H,4,7,10,28H2,1-2H3,(H,30,33)/t23-/m1/s1 |
| InChIKey | ABEDBKQBSVHVAN-HSZRJFAPSA-N |
| XLogP | 5.44 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|