C20H23N5O3S2 — CID 89215528
2-(3-amino-4-propan-2-yloxyphenyl)-5-[(1S)-1-(sulfamoylamino)-2,3-dihydro-1H-inden-4-yl]-1,3,4-thiadiazole (PubChem CID 89215528) has the molecular formula C20H23N5O3S2 and a molecular weight of 445.57 g/mol. Its IUPAC name is 2-(3-amino-4-propan-2-yloxyphenyl)-5-[(1S)-1-(sulfamoylamino)-2,3-dihydro-1H-inden-4-yl]-1,3,4-thiadiazole.
| Compound Name | 2-(3-amino-4-propan-2-yloxyphenyl)-5-[(1S)-1-(sulfamoylamino)-2,3-dihydro-1H-inden-4-yl]-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 89215528 |
| Molecular Formula | C20H23N5O3S2 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | 2-(3-amino-4-propan-2-yloxyphenyl)-5-[(1S)-1-(sulfamoylamino)-2,3-dihydro-1H-inden-4-yl]-1,3,4-thiadiazole |
| SMILES | CC(C)Oc1ccc(-c2nnc(-c3cccc4c3CC[C@@H]4NS(N)(=O)=O)s2)cc1N |
| InChI | InChI=1S/C20H23N5O3S2/c1-11(2)28-18-9-6-12(10-16(18)21)19-23-24-20(29-19)15-5-3-4-14-13(15)7-8-17(14)25-30(22,26)27/h3-6,9-11,17,25H,7-8,21H2,1-2H3,(H2,22,26,27)/t17-/m0/s1 |
| InChIKey | LOVXYIZDVXKZEO-KRWDZBQOSA-N |
| XLogP | 3.02 |
| TPSA | 133.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|