C17H12F6O2 — CID 89215532
4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3-methylphenyl]benzaldehyde (PubChem CID 89215532) has the molecular formula C17H12F6O2 and a molecular weight of 362.27 g/mol. Its IUPAC name is 4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3-methylphenyl]benzaldehyde.
| Compound Name | 4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3-methylphenyl]benzaldehyde |
|---|---|
| PubChem CID | 89215532 |
| Molecular Formula | C17H12F6O2 |
| Molecular Weight | 362.27 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3-methylphenyl]benzaldehyde |
| SMILES | Cc1cc(-c2ccc(C=O)cc2)ccc1C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C17H12F6O2/c1-10-8-13(12-4-2-11(9-24)3-5-12)6-7-14(10)15(25,16(18,19)20)17(21,22)23/h2-9,25H,1H3 |
| InChIKey | VVWMXOPAKFBFDL-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.27 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|