About (3R)-3-amino-2,2-difluoro-3-[(1S,2S)-2-methylcyclopropyl]butan-1-ol
(3R)-3-amino-2,2-difluoro-3-[(1S,2S)-2-methylcyclopropyl]butan-1-ol (PubChem CID 89215546) has the molecular formula C8H15F2NO
and a molecular weight of 179.21 g/mol. Its IUPAC name is (3R)-3-amino-2,2-difluoro-3-[(1S,2S)-2-methylcyclopropyl]butan-1-ol.
Molecular Properties
| Compound Name | (3R)-3-amino-2,2-difluoro-3-[(1S,2S)-2-methylcyclopropyl]butan-1-ol |
| PubChem CID | 89215546 |
| Molecular Formula | C8H15F2NO |
| Molecular Weight | 179.21 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | (3R)-3-amino-2,2-difluoro-3-[(1S,2S)-2-methylcyclopropyl]butan-1-ol |
| SMILES | C[C@H]1C[C@@H]1[C@@](C)(N)C(F)(F)CO |
| InChI | InChI=1S/C8H15F2NO/c1-5-3-6(5)7(2,11)8(9,10)4-12/h5-6,12H,3-4,11H2,1-2H3/t5-,6-,7+/m0/s1 |
| InChIKey | GGNXYJGDZGIOSB-LYFYHCNISA-N |
| XLogP | 0.99 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.21 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R)-3-amino-2,2-difluoro-3-[(1S,2S)-2-methylcyclopropyl]butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-amino-2,2-difluoro-3-[(1S,2S)-2-methylcyclopropyl]butan-1-ol?
The IUPAC name of (3R)-3-amino-2,2-difluoro-3-[(1S,2S)-2-methylcyclopropyl]butan-1-ol (CID 89215546) is (3R)-3-amino-2,2-difluoro-3-[(1S,2S)-2-methylcyclopropyl]butan-1-ol.
What is the SMILES notation for (3R)-3-amino-2,2-difluoro-3-[(1S,2S)-2-methylcyclopropyl]butan-1-ol?
The canonical SMILES for (3R)-3-amino-2,2-difluoro-3-[(1S,2S)-2-methylcyclopropyl]butan-1-ol is C[C@H]1C[C@@H]1[C@@](C)(N)C(F)(F)CO.
What is the InChIKey of (3R)-3-amino-2,2-difluoro-3-[(1S,2S)-2-methylcyclopropyl]butan-1-ol?
The InChIKey is GGNXYJGDZGIOSB-LYFYHCNISA-N. The full InChI is InChI=1S/C8H15F2NO/c1-5-3-6(5)7(2,11)8(9,10)4-12/h5-6,12H,3-4,11H2,1-2H3/t5-,6-,7+/m0/s1.
What are the key properties of (3R)-3-amino-2,2-difluoro-3-[(1S,2S)-2-methylcyclopropyl]butan-1-ol?
(3R)-3-amino-2,2-difluoro-3-[(1S,2S)-2-methylcyclopropyl]butan-1-ol has a molecular weight of 179.21 g/mol, XLogP of 0.99, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-amino-2,2-difluoro-3-[(1S,2S)-2-methylcyclopropyl]butan-1-ol is sourced from PubChem (CID 89215546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).