About (1Z,3E)-1-amino-5-fluoropenta-1,3-diene-3-thiol
(1Z,3E)-1-amino-5-fluoropenta-1,3-diene-3-thiol (PubChem CID 89215648) has the molecular formula C5H8FNS
and a molecular weight of 133.19 g/mol. Its IUPAC name is (1Z,3E)-1-amino-5-fluoropenta-1,3-diene-3-thiol.
Molecular Properties
| Compound Name | (1Z,3E)-1-amino-5-fluoropenta-1,3-diene-3-thiol |
| PubChem CID | 89215648 |
| Molecular Formula | C5H8FNS |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.04 |
| IUPAC Name | (1Z,3E)-1-amino-5-fluoropenta-1,3-diene-3-thiol |
| SMILES | N/C=C\C(S)=C/CF |
| InChI | InChI=1S/C5H8FNS/c6-3-1-5(8)2-4-7/h1-2,4,8H,3,7H2/b4-2-,5-1+ |
| InChIKey | ADYWRMLNBPMLPM-OVNQPXIVSA-N |
| XLogP | 1.24 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (1Z,3E)-1-amino-5-fluoropenta-1,3-diene-3-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z,3E)-1-amino-5-fluoropenta-1,3-diene-3-thiol?
The IUPAC name of (1Z,3E)-1-amino-5-fluoropenta-1,3-diene-3-thiol (CID 89215648) is (1Z,3E)-1-amino-5-fluoropenta-1,3-diene-3-thiol.
What is the SMILES notation for (1Z,3E)-1-amino-5-fluoropenta-1,3-diene-3-thiol?
The canonical SMILES for (1Z,3E)-1-amino-5-fluoropenta-1,3-diene-3-thiol is N/C=C\C(S)=C/CF.
What is the InChIKey of (1Z,3E)-1-amino-5-fluoropenta-1,3-diene-3-thiol?
The InChIKey is ADYWRMLNBPMLPM-OVNQPXIVSA-N. The full InChI is InChI=1S/C5H8FNS/c6-3-1-5(8)2-4-7/h1-2,4,8H,3,7H2/b4-2-,5-1+.
What are the key properties of (1Z,3E)-1-amino-5-fluoropenta-1,3-diene-3-thiol?
(1Z,3E)-1-amino-5-fluoropenta-1,3-diene-3-thiol has a molecular weight of 133.19 g/mol, XLogP of 1.24, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z,3E)-1-amino-5-fluoropenta-1,3-diene-3-thiol is sourced from PubChem (CID 89215648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).