C28H31F6N3O — CID 89215652
2-[4-[4-[[4-[(2E)-2-[(Z)-2-aminoethenyl]penta-2,4-dienyl]piperazin-1-yl]methyl]-3-methylphenyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 89215652) has the molecular formula C28H31F6N3O and a molecular weight of 539.56 g/mol. Its IUPAC name is 2-[4-[4-[[4-[(2E)-2-[(Z)-2-aminoethenyl]penta-2,4-dienyl]piperazin-1-yl]methyl]-3-methylphenyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[4-[4-[[4-[(2E)-2-[(Z)-2-aminoethenyl]penta-2,4-dienyl]piperazin-1-yl]methyl]-3-methylphenyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 89215652 |
| Molecular Formula | C28H31F6N3O |
| Molecular Weight | 539.56 g/mol |
| Exact Mass | 539.24 |
| IUPAC Name | 2-[4-[4-[[4-[(2E)-2-[(Z)-2-aminoethenyl]penta-2,4-dienyl]piperazin-1-yl]methyl]-3-methylphenyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | C=C/C=C(\C=C/N)CN1CCN(Cc2ccc(-c3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)cc2C)CC1 |
| InChI | InChI=1S/C28H31F6N3O/c1-3-4-21(11-12-35)18-36-13-15-37(16-14-36)19-24-6-5-23(17-20(24)2)22-7-9-25(10-8-22)26(38,27(29,30)31)28(32,33)34/h3-12,17,38H,1,13-16,18-19,35H2,2H3/b12-11-,21-4+ |
| InChIKey | HCYUSIRDUINSBZ-NICDPIFHSA-N |
| XLogP | 5.68 |
| TPSA | 52.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.56 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|