About 6-ethyl-3-methylidene-1,7-dioxaspiro[4.4]nonan-2-one
6-ethyl-3-methylidene-1,7-dioxaspiro[4.4]nonan-2-one (PubChem CID 89215662) has the molecular formula C10H14O3
and a molecular weight of 182.22 g/mol. Its IUPAC name is 6-ethyl-3-methylidene-1,7-dioxaspiro[4.4]nonan-2-one.
Molecular Properties
| Compound Name | 6-ethyl-3-methylidene-1,7-dioxaspiro[4.4]nonan-2-one |
| PubChem CID | 89215662 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 6-ethyl-3-methylidene-1,7-dioxaspiro[4.4]nonan-2-one |
| SMILES | C=C1CC2(CCOC2CC)OC1=O |
| InChI | InChI=1S/C10H14O3/c1-3-8-10(4-5-12-8)6-7(2)9(11)13-10/h8H,2-6H2,1H3 |
| InChIKey | HHSXTFVHNXFFFX-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 6-ethyl-3-methylidene-1,7-dioxaspiro[4.4]nonan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-3-methylidene-1,7-dioxaspiro[4.4]nonan-2-one?
The IUPAC name of 6-ethyl-3-methylidene-1,7-dioxaspiro[4.4]nonan-2-one (CID 89215662) is 6-ethyl-3-methylidene-1,7-dioxaspiro[4.4]nonan-2-one.
What is the SMILES notation for 6-ethyl-3-methylidene-1,7-dioxaspiro[4.4]nonan-2-one?
The canonical SMILES for 6-ethyl-3-methylidene-1,7-dioxaspiro[4.4]nonan-2-one is C=C1CC2(CCOC2CC)OC1=O.
What is the InChIKey of 6-ethyl-3-methylidene-1,7-dioxaspiro[4.4]nonan-2-one?
The InChIKey is HHSXTFVHNXFFFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O3/c1-3-8-10(4-5-12-8)6-7(2)9(11)13-10/h8H,2-6H2,1H3.
What are the key properties of 6-ethyl-3-methylidene-1,7-dioxaspiro[4.4]nonan-2-one?
6-ethyl-3-methylidene-1,7-dioxaspiro[4.4]nonan-2-one has a molecular weight of 182.22 g/mol, XLogP of 1.43, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-3-methylidene-1,7-dioxaspiro[4.4]nonan-2-one is sourced from PubChem (CID 89215662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).