C26H23F8N3O — CID 89215764
2-[4-[4-[[4-[(3,5-difluoro-4-pyridinyl)methyl]piperazin-1-yl]methyl]phenyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 89215764) has the molecular formula C26H23F8N3O and a molecular weight of 545.47 g/mol. Its IUPAC name is 2-[4-[4-[[4-[(3,5-difluoro-4-pyridinyl)methyl]piperazin-1-yl]methyl]phenyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[4-[4-[[4-[(3,5-difluoro-4-pyridinyl)methyl]piperazin-1-yl]methyl]phenyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 89215764 |
| Molecular Formula | C26H23F8N3O |
| Molecular Weight | 545.47 g/mol |
| Exact Mass | 545.17 |
| IUPAC Name | 2-[4-[4-[[4-[(3,5-difluoro-4-pyridinyl)methyl]piperazin-1-yl]methyl]phenyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | OC(c1ccc(-c2ccc(CN3CCN(Cc4c(F)cncc4F)CC3)cc2)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C26H23F8N3O/c27-22-13-35-14-23(28)21(22)16-37-11-9-36(10-12-37)15-17-1-3-18(4-2-17)19-5-7-20(8-6-19)24(38,25(29,30)31)26(32,33)34/h1-8,13-14,38H,9-12,15-16H2 |
| InChIKey | GSYPGKRODZPCQA-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.47 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |