About phenyl N-[3-(1,1-difluoro-2-hydroxyethyl)-4-methyl-1-phenylpyrazol-5-yl]carbamate
phenyl N-[3-(1,1-difluoro-2-hydroxyethyl)-4-methyl-1-phenylpyrazol-5-yl]carbamate (PubChem CID 89215825) has the molecular formula C19H17F2N3O3
and a molecular weight of 373.36 g/mol. Its IUPAC name is phenyl N-[3-(1,1-difluoro-2-hydroxyethyl)-4-methyl-1-phenylpyrazol-5-yl]carbamate.
Molecular Properties
| Compound Name | phenyl N-[3-(1,1-difluoro-2-hydroxyethyl)-4-methyl-1-phenylpyrazol-5-yl]carbamate |
| PubChem CID | 89215825 |
| Molecular Formula | C19H17F2N3O3 |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | phenyl N-[3-(1,1-difluoro-2-hydroxyethyl)-4-methyl-1-phenylpyrazol-5-yl]carbamate |
| SMILES | Cc1c(C(F)(F)CO)nn(-c2ccccc2)c1NC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C19H17F2N3O3/c1-13-16(19(20,21)12-25)23-24(14-8-4-2-5-9-14)17(13)22-18(26)27-15-10-6-3-7-11-15/h2-11,25H,12H2,1H3,(H,22,26) |
| InChIKey | JVBNNCXVTJOLHK-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze phenyl N-[3-(1,1-difluoro-2-hydroxyethyl)-4-methyl-1-phenylpyrazol-5-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl N-[3-(1,1-difluoro-2-hydroxyethyl)-4-methyl-1-phenylpyrazol-5-yl]carbamate?
The IUPAC name of phenyl N-[3-(1,1-difluoro-2-hydroxyethyl)-4-methyl-1-phenylpyrazol-5-yl]carbamate (CID 89215825) is phenyl N-[3-(1,1-difluoro-2-hydroxyethyl)-4-methyl-1-phenylpyrazol-5-yl]carbamate.
What is the SMILES notation for phenyl N-[3-(1,1-difluoro-2-hydroxyethyl)-4-methyl-1-phenylpyrazol-5-yl]carbamate?
The canonical SMILES for phenyl N-[3-(1,1-difluoro-2-hydroxyethyl)-4-methyl-1-phenylpyrazol-5-yl]carbamate is Cc1c(C(F)(F)CO)nn(-c2ccccc2)c1NC(=O)Oc1ccccc1.
What is the InChIKey of phenyl N-[3-(1,1-difluoro-2-hydroxyethyl)-4-methyl-1-phenylpyrazol-5-yl]carbamate?
The InChIKey is JVBNNCXVTJOLHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17F2N3O3/c1-13-16(19(20,21)12-25)23-24(14-8-4-2-5-9-14)17(13)22-18(26)27-15-10-6-3-7-11-15/h2-11,25H,12H2,1H3,(H,22,26).
What are the key properties of phenyl N-[3-(1,1-difluoro-2-hydroxyethyl)-4-methyl-1-phenylpyrazol-5-yl]carbamate?
phenyl N-[3-(1,1-difluoro-2-hydroxyethyl)-4-methyl-1-phenylpyrazol-5-yl]carbamate has a molecular weight of 373.36 g/mol, XLogP of 3.88, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl N-[3-(1,1-difluoro-2-hydroxyethyl)-4-methyl-1-phenylpyrazol-5-yl]carbamate is sourced from PubChem (CID 89215825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).