C19H35F — CID 89215915
6-(fluoromethyl)-3,3,5,5,7,7,9-heptamethylundeca-1,10-diene (PubChem CID 89215915) has the molecular formula C19H35F and a molecular weight of 282.49 g/mol. Its IUPAC name is 6-(fluoromethyl)-3,3,5,5,7,7,9-heptamethylundeca-1,10-diene.
| Compound Name | 6-(fluoromethyl)-3,3,5,5,7,7,9-heptamethylundeca-1,10-diene |
|---|---|
| PubChem CID | 89215915 |
| Molecular Formula | C19H35F |
| Molecular Weight | 282.49 g/mol |
| Exact Mass | 282.27 |
| IUPAC Name | 6-(fluoromethyl)-3,3,5,5,7,7,9-heptamethylundeca-1,10-diene |
| SMILES | C=CC(C)CC(C)(C)C(CF)C(C)(C)CC(C)(C)C=C |
| InChI | InChI=1S/C19H35F/c1-10-15(3)12-18(6,7)16(13-20)19(8,9)14-17(4,5)11-2/h10-11,15-16H,1-2,12-14H2,3-9H3 |
| InChIKey | FINHCGUOSCMEAB-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.49 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|