C6H8F6N2O6S2 — CID 89216079
(2R,5R)-2,5-dihydroxy-2,5-bis(trifluoromethyl)piperazine-1,4-disulfinic acid (PubChem CID 89216079) has the molecular formula C6H8F6N2O6S2 and a molecular weight of 382.26 g/mol. Its IUPAC name is (2R,5R)-2,5-dihydroxy-2,5-bis(trifluoromethyl)piperazine-1,4-disulfinic acid.
| Compound Name | (2R,5R)-2,5-dihydroxy-2,5-bis(trifluoromethyl)piperazine-1,4-disulfinic acid |
|---|---|
| PubChem CID | 89216079 |
| Molecular Formula | C6H8F6N2O6S2 |
| Molecular Weight | 382.26 g/mol |
| Exact Mass | 381.97 |
| IUPAC Name | (2R,5R)-2,5-dihydroxy-2,5-bis(trifluoromethyl)piperazine-1,4-disulfinic acid |
| SMILES | O=S(O)N1C[C@@](O)(C(F)(F)F)N(S(=O)O)C[C@@]1(O)C(F)(F)F |
| InChI | InChI=1S/C6H8F6N2O6S2/c7-5(8,9)3(15)1-13(21(17)18)4(16,6(10,11)12)2-14(3)22(19)20/h15-16H,1-2H2,(H,17,18)(H,19,20)/t3-,4-/m1/s1 |
| InChIKey | VESQVZLTOTUIMK-QWWZWVQMSA-N |
| XLogP | -0.62 |
| TPSA | 121.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.26 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|