C13H20F6O6 — CID 89216127
(2S,3S,5R,6S)-6-methoxy-3,6-di(propan-2-yl)-2,5-bis(trifluoromethyl)-1,4-dioxane-2,3,5-triol (PubChem CID 89216127) has the molecular formula C13H20F6O6 and a molecular weight of 386.29 g/mol. Its IUPAC name is (2S,3S,5R,6S)-6-methoxy-3,6-di(propan-2-yl)-2,5-bis(trifluoromethyl)-1,4-dioxane-2,3,5-triol.
| Compound Name | (2S,3S,5R,6S)-6-methoxy-3,6-di(propan-2-yl)-2,5-bis(trifluoromethyl)-1,4-dioxane-2,3,5-triol |
|---|---|
| PubChem CID | 89216127 |
| Molecular Formula | C13H20F6O6 |
| Molecular Weight | 386.29 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | (2S,3S,5R,6S)-6-methoxy-3,6-di(propan-2-yl)-2,5-bis(trifluoromethyl)-1,4-dioxane-2,3,5-triol |
| SMILES | CO[C@@]1(C(C)C)O[C@](O)(C(F)(F)F)[C@](O)(C(C)C)O[C@@]1(O)C(F)(F)F |
| InChI | InChI=1S/C13H20F6O6/c1-6(2)8(20)10(21,12(14,15)16)25-9(23-5,7(3)4)11(22,24-8)13(17,18)19/h6-7,20-22H,1-5H3/t8-,9-,10-,11+/m0/s1 |
| InChIKey | JIJUMVBAGFWVAI-XWLWVQCSSA-N |
| XLogP | 1.88 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.29 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |