C24H21F3N6O5 — CID 89216272
N-[9-[(1S,3R,4S)-1-ethyl-7-hydroxy-2,5-dioxabicyclo[2.2.1]heptan-3-yl]-8-[3-[(2,2,2-trifluoroacetyl)amino]prop-1-ynyl]purin-6-yl]benzamide (PubChem CID 89216272) has the molecular formula C24H21F3N6O5 and a molecular weight of 530.46 g/mol. Its IUPAC name is N-[9-[(1S,3R,4S)-1-ethyl-7-hydroxy-2,5-dioxabicyclo[2.2.1]heptan-3-yl]-8-[3-[(2,2,2-trifluoroacetyl)amino]prop-1-ynyl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(1S,3R,4S)-1-ethyl-7-hydroxy-2,5-dioxabicyclo[2.2.1]heptan-3-yl]-8-[3-[(2,2,2-trifluoroacetyl)amino]prop-1-ynyl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 89216272 |
| Molecular Formula | C24H21F3N6O5 |
| Molecular Weight | 530.46 g/mol |
| Exact Mass | 530.15 |
| IUPAC Name | N-[9-[(1S,3R,4S)-1-ethyl-7-hydroxy-2,5-dioxabicyclo[2.2.1]heptan-3-yl]-8-[3-[(2,2,2-trifluoroacetyl)amino]prop-1-ynyl]purin-6-yl]benzamide |
| SMILES | CC[C@]12CO[C@@H](C1O)[C@H](n1c(C#CCNC(=O)C(F)(F)F)nc3c(NC(=O)c4ccccc4)ncnc31)O2 |
| InChI | InChI=1S/C24H21F3N6O5/c1-2-23-11-37-16(17(23)34)21(38-23)33-14(9-6-10-28-22(36)24(25,26)27)31-15-18(29-12-30-19(15)33)32-20(35)13-7-4-3-5-8-13/h3-5,7-8,12,16-17,21,34H,2,10-11H2,1H3,(H,28,36)(H,29,30,32,35)/t16-,17?,21+,23-/m0/s1 |
| InChIKey | NUPVNVJPMHPMEN-ADLSCUKJSA-N |
| XLogP | 1.55 |
| TPSA | 140.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.46 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|