C24H25ClFN5O5 — CID 89216505
(2S)-1-N-(1-carbamoylindol-3-yl)-2-N-[(3-chloro-2-fluorophenyl)methyl]-4,4-dimethoxypyrrolidine-1,2-dicarboxamide (PubChem CID 89216505) has the molecular formula C24H25ClFN5O5 and a molecular weight of 517.95 g/mol. Its IUPAC name is (2S)-1-N-(1-carbamoylindol-3-yl)-2-N-[(3-chloro-2-fluorophenyl)methyl]-4,4-dimethoxypyrrolidine-1,2-dicarboxamide.
| Compound Name | (2S)-1-N-(1-carbamoylindol-3-yl)-2-N-[(3-chloro-2-fluorophenyl)methyl]-4,4-dimethoxypyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 89216505 |
| Molecular Formula | C24H25ClFN5O5 |
| Molecular Weight | 517.95 g/mol |
| Exact Mass | 517.15 |
| IUPAC Name | (2S)-1-N-(1-carbamoylindol-3-yl)-2-N-[(3-chloro-2-fluorophenyl)methyl]-4,4-dimethoxypyrrolidine-1,2-dicarboxamide |
| SMILES | COC1(OC)C[C@@H](C(=O)NCc2cccc(Cl)c2F)N(C(=O)Nc2cn(C(N)=O)c3ccccc23)C1 |
| InChI | InChI=1S/C24H25ClFN5O5/c1-35-24(36-2)10-19(21(32)28-11-14-6-5-8-16(25)20(14)26)31(13-24)23(34)29-17-12-30(22(27)33)18-9-4-3-7-15(17)18/h3-9,12,19H,10-11,13H2,1-2H3,(H2,27,33)(H,28,32)(H,29,34)/t19-/m0/s1 |
| InChIKey | QLOHYIUOSHXRRB-IBGZPJMESA-N |
| XLogP | 3.27 |
| TPSA | 127.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.95 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|