C27H27F6N3O4 — CID 89216975
2-[(3R,6S)-6-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-3-(2,4-dioxoimidazolidin-1-yl)-6-phenylpiperidin-3-yl]acetaldehyde (PubChem CID 89216975) has the molecular formula C27H27F6N3O4 and a molecular weight of 571.52 g/mol. Its IUPAC name is 2-[(3R,6S)-6-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-3-(2,4-dioxoimidazolidin-1-yl)-6-phenylpiperidin-3-yl]acetaldehyde.
| Compound Name | 2-[(3R,6S)-6-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-3-(2,4-dioxoimidazolidin-1-yl)-6-phenylpiperidin-3-yl]acetaldehyde |
|---|---|
| PubChem CID | 89216975 |
| Molecular Formula | C27H27F6N3O4 |
| Molecular Weight | 571.52 g/mol |
| Exact Mass | 571.19 |
| IUPAC Name | 2-[(3R,6S)-6-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-3-(2,4-dioxoimidazolidin-1-yl)-6-phenylpiperidin-3-yl]acetaldehyde |
| SMILES | C[C@@H](OC[C@@]1(c2ccccc2)CC[C@](CC=O)(N2CC(=O)NC2=O)CN1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H27F6N3O4/c1-17(18-11-20(26(28,29)30)13-21(12-18)27(31,32)33)40-16-25(19-5-3-2-4-6-19)8-7-24(9-10-37,15-34-25)36-14-22(38)35-23(36)39/h2-6,10-13,17,34H,7-9,14-16H2,1H3,(H,35,38,39)/t17-,24-,25-/m1/s1 |
| InChIKey | XFCFOEQIDBMFRB-LJXNEXSDSA-N |
| XLogP | 4.96 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.52 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|