C15H23NO2 — CID 892170
2-(3-methylphenoxy)-N,N-di(propan-2-yl)acetamide (PubChem CID 892170) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is 2-(3-methylphenoxy)-N,N-di(propan-2-yl)acetamide.
| Compound Name | 2-(3-methylphenoxy)-N,N-di(propan-2-yl)acetamide |
|---|---|
| PubChem CID | 892170 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 2-(3-methylphenoxy)-N,N-di(propan-2-yl)acetamide |
| SMILES | Cc1cccc(OCC(=O)N(C(C)C)C(C)C)c1 |
| InChI | InChI=1S/C15H23NO2/c1-11(2)16(12(3)4)15(17)10-18-14-8-6-7-13(5)9-14/h6-9,11-12H,10H2,1-5H3 |
| InChIKey | XXNUFPUAOYBFTC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |