About 4-methylbicyclo[4.1.0]hepta-2,4-dien-2-amine
4-methylbicyclo[4.1.0]hepta-2,4-dien-2-amine (PubChem CID 89217026) has the molecular formula C8H11N
and a molecular weight of 121.18 g/mol. Its IUPAC name is 4-methylbicyclo[4.1.0]hepta-2,4-dien-2-amine.
Molecular Properties
| Compound Name | 4-methylbicyclo[4.1.0]hepta-2,4-dien-2-amine |
| PubChem CID | 89217026 |
| Molecular Formula | C8H11N |
| Molecular Weight | 121.18 g/mol |
| Exact Mass | 121.09 |
| IUPAC Name | 4-methylbicyclo[4.1.0]hepta-2,4-dien-2-amine |
| SMILES | CC1=CC2CC2C(N)=C1 |
| InChI | InChI=1S/C8H11N/c1-5-2-6-4-7(6)8(9)3-5/h2-3,6-7H,4,9H2,1H3 |
| InChIKey | AISWIAOIGQMESK-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.18 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-methylbicyclo[4.1.0]hepta-2,4-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylbicyclo[4.1.0]hepta-2,4-dien-2-amine?
The IUPAC name of 4-methylbicyclo[4.1.0]hepta-2,4-dien-2-amine (CID 89217026) is 4-methylbicyclo[4.1.0]hepta-2,4-dien-2-amine.
What is the SMILES notation for 4-methylbicyclo[4.1.0]hepta-2,4-dien-2-amine?
The canonical SMILES for 4-methylbicyclo[4.1.0]hepta-2,4-dien-2-amine is CC1=CC2CC2C(N)=C1.
What is the InChIKey of 4-methylbicyclo[4.1.0]hepta-2,4-dien-2-amine?
The InChIKey is AISWIAOIGQMESK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N/c1-5-2-6-4-7(6)8(9)3-5/h2-3,6-7H,4,9H2,1H3.
What are the key properties of 4-methylbicyclo[4.1.0]hepta-2,4-dien-2-amine?
4-methylbicyclo[4.1.0]hepta-2,4-dien-2-amine has a molecular weight of 121.18 g/mol, XLogP of 1.42, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylbicyclo[4.1.0]hepta-2,4-dien-2-amine is sourced from PubChem (CID 89217026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).