About (5Z,6Z)-1-imidazol-1-yl-9-methyl-5-prop-2-enylidenedeca-6,8-dien-2-one
(5Z,6Z)-1-imidazol-1-yl-9-methyl-5-prop-2-enylidenedeca-6,8-dien-2-one (PubChem CID 89217183) has the molecular formula C17H22N2O
and a molecular weight of 270.38 g/mol. Its IUPAC name is (5Z,6Z)-1-imidazol-1-yl-9-methyl-5-prop-2-enylidenedeca-6,8-dien-2-one.
Molecular Properties
| Compound Name | (5Z,6Z)-1-imidazol-1-yl-9-methyl-5-prop-2-enylidenedeca-6,8-dien-2-one |
| PubChem CID | 89217183 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | (5Z,6Z)-1-imidazol-1-yl-9-methyl-5-prop-2-enylidenedeca-6,8-dien-2-one |
| SMILES | C=C/C=C(\C=C/C=C(C)C)CCC(=O)Cn1ccnc1 |
| InChI | InChI=1S/C17H22N2O/c1-4-6-16(8-5-7-15(2)3)9-10-17(20)13-19-12-11-18-14-19/h4-8,11-12,14H,1,9-10,13H2,2-3H3/b8-5-,16-6+ |
| InChIKey | CORMDFCVLLPAGI-BDXRTRMVSA-N |
| XLogP | 3.87 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (5Z,6Z)-1-imidazol-1-yl-9-methyl-5-prop-2-enylidenedeca-6,8-dien-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z,6Z)-1-imidazol-1-yl-9-methyl-5-prop-2-enylidenedeca-6,8-dien-2-one?
The IUPAC name of (5Z,6Z)-1-imidazol-1-yl-9-methyl-5-prop-2-enylidenedeca-6,8-dien-2-one (CID 89217183) is (5Z,6Z)-1-imidazol-1-yl-9-methyl-5-prop-2-enylidenedeca-6,8-dien-2-one.
What is the SMILES notation for (5Z,6Z)-1-imidazol-1-yl-9-methyl-5-prop-2-enylidenedeca-6,8-dien-2-one?
The canonical SMILES for (5Z,6Z)-1-imidazol-1-yl-9-methyl-5-prop-2-enylidenedeca-6,8-dien-2-one is C=C/C=C(\C=C/C=C(C)C)CCC(=O)Cn1ccnc1.
What is the InChIKey of (5Z,6Z)-1-imidazol-1-yl-9-methyl-5-prop-2-enylidenedeca-6,8-dien-2-one?
The InChIKey is CORMDFCVLLPAGI-BDXRTRMVSA-N. The full InChI is InChI=1S/C17H22N2O/c1-4-6-16(8-5-7-15(2)3)9-10-17(20)13-19-12-11-18-14-19/h4-8,11-12,14H,1,9-10,13H2,2-3H3/b8-5-,16-6+.
What are the key properties of (5Z,6Z)-1-imidazol-1-yl-9-methyl-5-prop-2-enylidenedeca-6,8-dien-2-one?
(5Z,6Z)-1-imidazol-1-yl-9-methyl-5-prop-2-enylidenedeca-6,8-dien-2-one has a molecular weight of 270.38 g/mol, XLogP of 3.87, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z,6Z)-1-imidazol-1-yl-9-methyl-5-prop-2-enylidenedeca-6,8-dien-2-one is sourced from PubChem (CID 89217183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).