About (6Z,8Z)-1-imidazol-1-yl-5-methylidenedeca-6,8-dien-2-one
(6Z,8Z)-1-imidazol-1-yl-5-methylidenedeca-6,8-dien-2-one (PubChem CID 89217195) has the molecular formula C14H18N2O
and a molecular weight of 230.31 g/mol. Its IUPAC name is (6Z,8Z)-1-imidazol-1-yl-5-methylidenedeca-6,8-dien-2-one.
Molecular Properties
| Compound Name | (6Z,8Z)-1-imidazol-1-yl-5-methylidenedeca-6,8-dien-2-one |
| PubChem CID | 89217195 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | (6Z,8Z)-1-imidazol-1-yl-5-methylidenedeca-6,8-dien-2-one |
| SMILES | C=C(/C=C\C=C/C)CCC(=O)Cn1ccnc1 |
| InChI | InChI=1S/C14H18N2O/c1-3-4-5-6-13(2)7-8-14(17)11-16-10-9-15-12-16/h3-6,9-10,12H,2,7-8,11H2,1H3/b4-3-,6-5- |
| InChIKey | APBNHMPVQDBHOH-OUPQRBNQSA-N |
| XLogP | 2.92 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (6Z,8Z)-1-imidazol-1-yl-5-methylidenedeca-6,8-dien-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6Z,8Z)-1-imidazol-1-yl-5-methylidenedeca-6,8-dien-2-one?
The IUPAC name of (6Z,8Z)-1-imidazol-1-yl-5-methylidenedeca-6,8-dien-2-one (CID 89217195) is (6Z,8Z)-1-imidazol-1-yl-5-methylidenedeca-6,8-dien-2-one.
What is the SMILES notation for (6Z,8Z)-1-imidazol-1-yl-5-methylidenedeca-6,8-dien-2-one?
The canonical SMILES for (6Z,8Z)-1-imidazol-1-yl-5-methylidenedeca-6,8-dien-2-one is C=C(/C=C\C=C/C)CCC(=O)Cn1ccnc1.
What is the InChIKey of (6Z,8Z)-1-imidazol-1-yl-5-methylidenedeca-6,8-dien-2-one?
The InChIKey is APBNHMPVQDBHOH-OUPQRBNQSA-N. The full InChI is InChI=1S/C14H18N2O/c1-3-4-5-6-13(2)7-8-14(17)11-16-10-9-15-12-16/h3-6,9-10,12H,2,7-8,11H2,1H3/b4-3-,6-5-.
What are the key properties of (6Z,8Z)-1-imidazol-1-yl-5-methylidenedeca-6,8-dien-2-one?
(6Z,8Z)-1-imidazol-1-yl-5-methylidenedeca-6,8-dien-2-one has a molecular weight of 230.31 g/mol, XLogP of 2.92, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6Z,8Z)-1-imidazol-1-yl-5-methylidenedeca-6,8-dien-2-one is sourced from PubChem (CID 89217195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).