C26H35FN4O4 — CID 89217385
N-[(3Z,5E)-6-amino-5-fluorohexa-1,3,5-trien-2-yl]-1-[(2R)-2-[[formyl(phenylmethoxy)amino]methyl]hexanoyl]pyrrolidine-2-carboxamide (PubChem CID 89217385) has the molecular formula C26H35FN4O4 and a molecular weight of 486.59 g/mol. Its IUPAC name is N-[(3Z,5E)-6-amino-5-fluorohexa-1,3,5-trien-2-yl]-1-[(2R)-2-[[formyl(phenylmethoxy)amino]methyl]hexanoyl]pyrrolidine-2-carboxamide.
| Compound Name | N-[(3Z,5E)-6-amino-5-fluorohexa-1,3,5-trien-2-yl]-1-[(2R)-2-[[formyl(phenylmethoxy)amino]methyl]hexanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 89217385 |
| Molecular Formula | C26H35FN4O4 |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | N-[(3Z,5E)-6-amino-5-fluorohexa-1,3,5-trien-2-yl]-1-[(2R)-2-[[formyl(phenylmethoxy)amino]methyl]hexanoyl]pyrrolidine-2-carboxamide |
| SMILES | C=C(/C=C\C(F)=C/N)NC(=O)C1CCCN1C(=O)[C@H](CCCC)CN(C=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H35FN4O4/c1-3-4-11-22(17-30(19-32)35-18-21-9-6-5-7-10-21)26(34)31-15-8-12-24(31)25(33)29-20(2)13-14-23(27)16-28/h5-7,9-10,13-14,16,19,22,24H,2-4,8,11-12,15,17-18,28H2,1H3,(H,29,33)/b14-13-,23-16+/t22-,24?/m1/s1 |
| InChIKey | LMRQQLXAYWIBAN-ZGAOOUDHSA-N |
| XLogP | 3.33 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|