C20H28FI2N3O — CID 89217428
5-fluoro-N-[1-(iodomethyl)-6-[(2S)-2-iodo-5-methylhexan-3-yl]cyclohexa-2,4-dien-1-yl]-1,3-dimethylpyrazole-4-carboxamide (PubChem CID 89217428) has the molecular formula C20H28FI2N3O and a molecular weight of 599.27 g/mol. Its IUPAC name is 5-fluoro-N-[1-(iodomethyl)-6-[(2S)-2-iodo-5-methylhexan-3-yl]cyclohexa-2,4-dien-1-yl]-1,3-dimethylpyrazole-4-carboxamide.
| Compound Name | 5-fluoro-N-[1-(iodomethyl)-6-[(2S)-2-iodo-5-methylhexan-3-yl]cyclohexa-2,4-dien-1-yl]-1,3-dimethylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 89217428 |
| Molecular Formula | C20H28FI2N3O |
| Molecular Weight | 599.27 g/mol |
| Exact Mass | 599.03 |
| IUPAC Name | 5-fluoro-N-[1-(iodomethyl)-6-[(2S)-2-iodo-5-methylhexan-3-yl]cyclohexa-2,4-dien-1-yl]-1,3-dimethylpyrazole-4-carboxamide |
| SMILES | Cc1nn(C)c(F)c1C(=O)NC1(CI)C=CC=CC1C(CC(C)C)[C@H](C)I |
| InChI | InChI=1S/C20H28FI2N3O/c1-12(2)10-15(13(3)23)16-8-6-7-9-20(16,11-22)24-19(27)17-14(4)25-26(5)18(17)21/h6-9,12-13,15-16H,10-11H2,1-5H3,(H,24,27)/t13-,15?,16?,20?/m0/s1 |
| InChIKey | AVJXAZHDEQOJLY-FBPHCRGOSA-N |
| XLogP | 5.00 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.27 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|