C7H13NS — CID 89217846
2,3,5-trimethyl-2,4-dihydro-1,3-thiazine (PubChem CID 89217846) has the molecular formula C7H13NS and a molecular weight of 143.25 g/mol. Its IUPAC name is 2,3,5-trimethyl-2,4-dihydro-1,3-thiazine.
| Compound Name | 2,3,5-trimethyl-2,4-dihydro-1,3-thiazine |
|---|---|
| PubChem CID | 89217846 |
| Molecular Formula | C7H13NS |
| Molecular Weight | 143.25 g/mol |
| Exact Mass | 143.08 |
| IUPAC Name | 2,3,5-trimethyl-2,4-dihydro-1,3-thiazine |
| SMILES | CC1=CSC(C)N(C)C1 |
| InChI | InChI=1S/C7H13NS/c1-6-4-8(3)7(2)9-5-6/h5,7H,4H2,1-3H3 |
| InChIKey | LRVHESKUWJTHSR-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.25 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |