About (Z,3E)-N'-methyl-3-prop-2-enylidenebut-1-ene-1,4-diamine
(Z,3E)-N'-methyl-3-prop-2-enylidenebut-1-ene-1,4-diamine (PubChem CID 89218789) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is (Z,3E)-N'-methyl-3-prop-2-enylidenebut-1-ene-1,4-diamine.
Molecular Properties
| Compound Name | (Z,3E)-N'-methyl-3-prop-2-enylidenebut-1-ene-1,4-diamine |
| PubChem CID | 89218789 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | (Z,3E)-N'-methyl-3-prop-2-enylidenebut-1-ene-1,4-diamine |
| SMILES | C=C/C=C(\C=C/N)CNC |
| InChI | InChI=1S/C8H14N2/c1-3-4-8(5-6-9)7-10-2/h3-6,10H,1,7,9H2,2H3/b6-5-,8-4+ |
| InChIKey | WKDBQSCIDXRGRR-QNMAEOQASA-N |
| XLogP | 0.79 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (Z,3E)-N'-methyl-3-prop-2-enylidenebut-1-ene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z,3E)-N'-methyl-3-prop-2-enylidenebut-1-ene-1,4-diamine?
The IUPAC name of (Z,3E)-N'-methyl-3-prop-2-enylidenebut-1-ene-1,4-diamine (CID 89218789) is (Z,3E)-N'-methyl-3-prop-2-enylidenebut-1-ene-1,4-diamine.
What is the SMILES notation for (Z,3E)-N'-methyl-3-prop-2-enylidenebut-1-ene-1,4-diamine?
The canonical SMILES for (Z,3E)-N'-methyl-3-prop-2-enylidenebut-1-ene-1,4-diamine is C=C/C=C(\C=C/N)CNC.
What is the InChIKey of (Z,3E)-N'-methyl-3-prop-2-enylidenebut-1-ene-1,4-diamine?
The InChIKey is WKDBQSCIDXRGRR-QNMAEOQASA-N. The full InChI is InChI=1S/C8H14N2/c1-3-4-8(5-6-9)7-10-2/h3-6,10H,1,7,9H2,2H3/b6-5-,8-4+.
What are the key properties of (Z,3E)-N'-methyl-3-prop-2-enylidenebut-1-ene-1,4-diamine?
(Z,3E)-N'-methyl-3-prop-2-enylidenebut-1-ene-1,4-diamine has a molecular weight of 138.21 g/mol, XLogP of 0.79, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z,3E)-N'-methyl-3-prop-2-enylidenebut-1-ene-1,4-diamine is sourced from PubChem (CID 89218789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).