About 2-(2,3-dihydrofuran-2-carbonylamino)acetic acid
2-(2,3-dihydrofuran-2-carbonylamino)acetic acid (PubChem CID 89219246) has the molecular formula C7H9NO4
and a molecular weight of 171.15 g/mol. Its IUPAC name is 2-(2,3-dihydrofuran-2-carbonylamino)acetic acid.
Molecular Properties
| Compound Name | 2-(2,3-dihydrofuran-2-carbonylamino)acetic acid |
| PubChem CID | 89219246 |
| Molecular Formula | C7H9NO4 |
| Molecular Weight | 171.15 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | 2-(2,3-dihydrofuran-2-carbonylamino)acetic acid |
| SMILES | O=C(O)CNC(=O)C1CC=CO1 |
| InChI | InChI=1S/C7H9NO4/c9-6(10)4-8-7(11)5-2-1-3-12-5/h1,3,5H,2,4H2,(H,8,11)(H,9,10) |
| InChIKey | PFZSGWZRHQMNDW-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.15 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2,3-dihydrofuran-2-carbonylamino)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dihydrofuran-2-carbonylamino)acetic acid?
The IUPAC name of 2-(2,3-dihydrofuran-2-carbonylamino)acetic acid (CID 89219246) is 2-(2,3-dihydrofuran-2-carbonylamino)acetic acid.
What is the SMILES notation for 2-(2,3-dihydrofuran-2-carbonylamino)acetic acid?
The canonical SMILES for 2-(2,3-dihydrofuran-2-carbonylamino)acetic acid is O=C(O)CNC(=O)C1CC=CO1.
What is the InChIKey of 2-(2,3-dihydrofuran-2-carbonylamino)acetic acid?
The InChIKey is PFZSGWZRHQMNDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO4/c9-6(10)4-8-7(11)5-2-1-3-12-5/h1,3,5H,2,4H2,(H,8,11)(H,9,10).
What are the key properties of 2-(2,3-dihydrofuran-2-carbonylamino)acetic acid?
2-(2,3-dihydrofuran-2-carbonylamino)acetic acid has a molecular weight of 171.15 g/mol, XLogP of -0.51, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dihydrofuran-2-carbonylamino)acetic acid is sourced from PubChem (CID 89219246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).