C24H15BCl2FN3O3 — CID 89219624
CID 89219624 (PubChem CID 89219624) has the molecular formula C24H15BCl2FN3O3 and a molecular weight of 494.12 g/mol.
| Compound Name | CID 89219624 |
|---|---|
| PubChem CID | 89219624 |
| Molecular Formula | C24H15BCl2FN3O3 |
| Molecular Weight | 494.12 g/mol |
| Exact Mass | 493.06 |
| IUPAC Name | — |
| SMILES | [B]c1c(O)c(C)cc(C)c1-c1nnc(Cc2ccc(Cl)c(Oc3cc(Cl)cc(C#N)c3)c2F)o1 |
| InChI | InChI=1S/C24H15BCl2FN3O3/c1-11-5-12(2)22(32)20(25)19(11)24-31-30-18(34-24)8-14-3-4-17(27)23(21(14)28)33-16-7-13(10-29)6-15(26)9-16/h3-7,9,32H,8H2,1-2H3 |
| InChIKey | CRATXXSFBFCNBC-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 92.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.12 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|