C14H14F15NO2 — CID 89220132
4,4,5,5,6,6,7,7,8,9,9,9-dodecafluoro-1-morpholin-4-yl-8-(trifluoromethyl)nonan-2-ol (PubChem CID 89220132) has the molecular formula C14H14F15NO2 and a molecular weight of 513.24 g/mol. Its IUPAC name is 4,4,5,5,6,6,7,7,8,9,9,9-dodecafluoro-1-morpholin-4-yl-8-(trifluoromethyl)nonan-2-ol.
| Compound Name | 4,4,5,5,6,6,7,7,8,9,9,9-dodecafluoro-1-morpholin-4-yl-8-(trifluoromethyl)nonan-2-ol |
|---|---|
| PubChem CID | 89220132 |
| Molecular Formula | C14H14F15NO2 |
| Molecular Weight | 513.24 g/mol |
| Exact Mass | 513.08 |
| IUPAC Name | 4,4,5,5,6,6,7,7,8,9,9,9-dodecafluoro-1-morpholin-4-yl-8-(trifluoromethyl)nonan-2-ol |
| SMILES | OC(CN1CCOCC1)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H14F15NO2/c15-8(16,5-7(31)6-30-1-3-32-4-2-30)10(18,19)12(22,23)11(20,21)9(17,13(24,25)26)14(27,28)29/h7,31H,1-6H2 |
| InChIKey | YQZYPYYQTKTDAH-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.24 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|