C16H33NO — CID 89220244
(E,5R,6R)-4-[ethyl(methyl)amino]-3,3,6-trimethyldec-8-en-5-ol (PubChem CID 89220244) has the molecular formula C16H33NO and a molecular weight of 255.45 g/mol. Its IUPAC name is (E,5R,6R)-4-[ethyl(methyl)amino]-3,3,6-trimethyldec-8-en-5-ol.
| Compound Name | (E,5R,6R)-4-[ethyl(methyl)amino]-3,3,6-trimethyldec-8-en-5-ol |
|---|---|
| PubChem CID | 89220244 |
| Molecular Formula | C16H33NO |
| Molecular Weight | 255.45 g/mol |
| Exact Mass | 255.26 |
| IUPAC Name | (E,5R,6R)-4-[ethyl(methyl)amino]-3,3,6-trimethyldec-8-en-5-ol |
| SMILES | C/C=C/C[C@@H](C)[C@@H](O)C(N(C)CC)C(C)(C)CC |
| InChI | InChI=1S/C16H33NO/c1-8-11-12-13(4)14(18)15(17(7)10-3)16(5,6)9-2/h8,11,13-15,18H,9-10,12H2,1-7H3/b11-8+/t13-,14-,15?/m1/s1 |
| InChIKey | SFROPMDGKWQNLZ-UPSYVDGJSA-N |
| XLogP | 3.71 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|