C12H11F11O2 — CID 89220347
[difluoro-[1,1,1,2,3,3-hexafluoro-3-(1,2,2-trifluoroethenoxy)propan-2-yl]oxymethyl]cyclohexane (PubChem CID 89220347) has the molecular formula C12H11F11O2 and a molecular weight of 396.20 g/mol. Its IUPAC name is [difluoro-[1,1,1,2,3,3-hexafluoro-3-(1,2,2-trifluoroethenoxy)propan-2-yl]oxymethyl]cyclohexane.
| Compound Name | [difluoro-[1,1,1,2,3,3-hexafluoro-3-(1,2,2-trifluoroethenoxy)propan-2-yl]oxymethyl]cyclohexane |
|---|---|
| PubChem CID | 89220347 |
| Molecular Formula | C12H11F11O2 |
| Molecular Weight | 396.20 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | [difluoro-[1,1,1,2,3,3-hexafluoro-3-(1,2,2-trifluoroethenoxy)propan-2-yl]oxymethyl]cyclohexane |
| SMILES | FC(F)=C(F)OC(F)(F)C(F)(OC(F)(F)C1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C12H11F11O2/c13-7(14)8(15)24-12(22,23)10(18,11(19,20)21)25-9(16,17)6-4-2-1-3-5-6/h6H,1-5H2 |
| InChIKey | AEWZWTIDIPPYOA-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.20 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|