C22H29FO2 — CID 89220479
(2E,4Z,6E,8E)-4-fluoro-3,7-dimethyl-1-(oxiran-2-yl)-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-one (PubChem CID 89220479) has the molecular formula C22H29FO2 and a molecular weight of 344.47 g/mol. Its IUPAC name is (2E,4Z,6E,8E)-4-fluoro-3,7-dimethyl-1-(oxiran-2-yl)-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-one.
| Compound Name | (2E,4Z,6E,8E)-4-fluoro-3,7-dimethyl-1-(oxiran-2-yl)-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-one |
|---|---|
| PubChem CID | 89220479 |
| Molecular Formula | C22H29FO2 |
| Molecular Weight | 344.47 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | (2E,4Z,6E,8E)-4-fluoro-3,7-dimethyl-1-(oxiran-2-yl)-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-one |
| SMILES | CC1=C(/C=C/C(C)=C/C=C(F)/C(C)=C/C(=O)C2CO2)C(C)(C)CCC1 |
| InChI | InChI=1S/C22H29FO2/c1-15(8-10-18-16(2)7-6-12-22(18,4)5)9-11-19(23)17(3)13-20(24)21-14-25-21/h8-11,13,21H,6-7,12,14H2,1-5H3/b10-8+,15-9+,17-13+,19-11- |
| InChIKey | YYWSGONCPVMGOL-FSIYAHAYSA-N |
| XLogP | 5.78 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.47 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|