C9H11F3O — CID 89220895
(3Z,5Z)-5-methyl-2-(trifluoromethoxy)hepta-1,3,5-triene (PubChem CID 89220895) has the molecular formula C9H11F3O and a molecular weight of 192.18 g/mol. Its IUPAC name is (3Z,5Z)-5-methyl-2-(trifluoromethoxy)hepta-1,3,5-triene.
| Compound Name | (3Z,5Z)-5-methyl-2-(trifluoromethoxy)hepta-1,3,5-triene |
|---|---|
| PubChem CID | 89220895 |
| Molecular Formula | C9H11F3O |
| Molecular Weight | 192.18 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | (3Z,5Z)-5-methyl-2-(trifluoromethoxy)hepta-1,3,5-triene |
| SMILES | C=C(/C=C\C(C)=C/C)OC(F)(F)F |
| InChI | InChI=1S/C9H11F3O/c1-4-7(2)5-6-8(3)13-9(10,11)12/h4-6H,3H2,1-2H3/b6-5-,7-4- |
| InChIKey | OQAIGASPLMUMDJ-RNPBPNGMSA-N |
| XLogP | 3.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.18 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|