About (E)-2-[(1Z)-buta-1,3-dienyl]-N'-methylprop-1-ene-1,3-diamine
(E)-2-[(1Z)-buta-1,3-dienyl]-N'-methylprop-1-ene-1,3-diamine (PubChem CID 89220899) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is (E)-2-[(1Z)-buta-1,3-dienyl]-N'-methylprop-1-ene-1,3-diamine.
Molecular Properties
| Compound Name | (E)-2-[(1Z)-buta-1,3-dienyl]-N'-methylprop-1-ene-1,3-diamine |
| PubChem CID | 89220899 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | (E)-2-[(1Z)-buta-1,3-dienyl]-N'-methylprop-1-ene-1,3-diamine |
| SMILES | C=C/C=C\C(=C/N)CNC |
| InChI | InChI=1S/C8H14N2/c1-3-4-5-8(6-9)7-10-2/h3-6,10H,1,7,9H2,2H3/b5-4-,8-6+ |
| InChIKey | SCZDUBMWPVUDPJ-GSGSLZOQSA-N |
| XLogP | 0.79 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-[(1Z)-buta-1,3-dienyl]-N'-methylprop-1-ene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-[(1Z)-buta-1,3-dienyl]-N'-methylprop-1-ene-1,3-diamine?
The IUPAC name of (E)-2-[(1Z)-buta-1,3-dienyl]-N'-methylprop-1-ene-1,3-diamine (CID 89220899) is (E)-2-[(1Z)-buta-1,3-dienyl]-N'-methylprop-1-ene-1,3-diamine.
What is the SMILES notation for (E)-2-[(1Z)-buta-1,3-dienyl]-N'-methylprop-1-ene-1,3-diamine?
The canonical SMILES for (E)-2-[(1Z)-buta-1,3-dienyl]-N'-methylprop-1-ene-1,3-diamine is C=C/C=C\C(=C/N)CNC.
What is the InChIKey of (E)-2-[(1Z)-buta-1,3-dienyl]-N'-methylprop-1-ene-1,3-diamine?
The InChIKey is SCZDUBMWPVUDPJ-GSGSLZOQSA-N. The full InChI is InChI=1S/C8H14N2/c1-3-4-5-8(6-9)7-10-2/h3-6,10H,1,7,9H2,2H3/b5-4-,8-6+.
What are the key properties of (E)-2-[(1Z)-buta-1,3-dienyl]-N'-methylprop-1-ene-1,3-diamine?
(E)-2-[(1Z)-buta-1,3-dienyl]-N'-methylprop-1-ene-1,3-diamine has a molecular weight of 138.21 g/mol, XLogP of 0.79, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-[(1Z)-buta-1,3-dienyl]-N'-methylprop-1-ene-1,3-diamine is sourced from PubChem (CID 89220899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).