C12H14F6O2 — CID 89220997
2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3,3a,4,7,7a-hexahydro-1H-inden-1-ol (PubChem CID 89220997) has the molecular formula C12H14F6O2 and a molecular weight of 304.23 g/mol. Its IUPAC name is 2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3,3a,4,7,7a-hexahydro-1H-inden-1-ol.
| Compound Name | 2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3,3a,4,7,7a-hexahydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 89220997 |
| Molecular Formula | C12H14F6O2 |
| Molecular Weight | 304.23 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3,3a,4,7,7a-hexahydro-1H-inden-1-ol |
| SMILES | OC1C2CC=CCC2CC1C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H14F6O2/c13-11(14,15)10(20,12(16,17)18)8-5-6-3-1-2-4-7(6)9(8)19/h1-2,6-9,19-20H,3-5H2 |
| InChIKey | ZLNOYQBRHXHXHU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.23 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|