About (7-methoxy-2,2-dimethyl-3,4-dihydrochromen-6-yl) propanoate
(7-methoxy-2,2-dimethyl-3,4-dihydrochromen-6-yl) propanoate (PubChem CID 89221071) has the molecular formula C15H20O4
and a molecular weight of 264.32 g/mol. Its IUPAC name is (7-methoxy-2,2-dimethyl-3,4-dihydrochromen-6-yl) propanoate.
Molecular Properties
| Compound Name | (7-methoxy-2,2-dimethyl-3,4-dihydrochromen-6-yl) propanoate |
| PubChem CID | 89221071 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | (7-methoxy-2,2-dimethyl-3,4-dihydrochromen-6-yl) propanoate |
| SMILES | CCC(=O)Oc1cc2c(cc1OC)OC(C)(C)CC2 |
| InChI | InChI=1S/C15H20O4/c1-5-14(16)18-13-8-10-6-7-15(2,3)19-11(10)9-12(13)17-4/h8-9H,5-7H2,1-4H3 |
| InChIKey | LVCRNVYUXKGHGL-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (7-methoxy-2,2-dimethyl-3,4-dihydrochromen-6-yl) propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-methoxy-2,2-dimethyl-3,4-dihydrochromen-6-yl) propanoate?
The IUPAC name of (7-methoxy-2,2-dimethyl-3,4-dihydrochromen-6-yl) propanoate (CID 89221071) is (7-methoxy-2,2-dimethyl-3,4-dihydrochromen-6-yl) propanoate.
What is the SMILES notation for (7-methoxy-2,2-dimethyl-3,4-dihydrochromen-6-yl) propanoate?
The canonical SMILES for (7-methoxy-2,2-dimethyl-3,4-dihydrochromen-6-yl) propanoate is CCC(=O)Oc1cc2c(cc1OC)OC(C)(C)CC2.
What is the InChIKey of (7-methoxy-2,2-dimethyl-3,4-dihydrochromen-6-yl) propanoate?
The InChIKey is LVCRNVYUXKGHGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O4/c1-5-14(16)18-13-8-10-6-7-15(2,3)19-11(10)9-12(13)17-4/h8-9H,5-7H2,1-4H3.
What are the key properties of (7-methoxy-2,2-dimethyl-3,4-dihydrochromen-6-yl) propanoate?
(7-methoxy-2,2-dimethyl-3,4-dihydrochromen-6-yl) propanoate has a molecular weight of 264.32 g/mol, XLogP of 3.11, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (7-methoxy-2,2-dimethyl-3,4-dihydrochromen-6-yl) propanoate is sourced from PubChem (CID 89221071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).