C11H9BN2O2 — CID 89221453
4-(4,5-dimethylidene-1,3,2-dioxaborolan-2-yl)-1H-indazole (PubChem CID 89221453) has the molecular formula C11H9BN2O2 and a molecular weight of 212.02 g/mol. Its IUPAC name is 4-(4,5-dimethylidene-1,3,2-dioxaborolan-2-yl)-1H-indazole.
| Compound Name | 4-(4,5-dimethylidene-1,3,2-dioxaborolan-2-yl)-1H-indazole |
|---|---|
| PubChem CID | 89221453 |
| Molecular Formula | C11H9BN2O2 |
| Molecular Weight | 212.02 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 4-(4,5-dimethylidene-1,3,2-dioxaborolan-2-yl)-1H-indazole |
| SMILES | C=C1OB(c2cccc3[nH]ncc23)OC1=C |
| InChI | InChI=1S/C11H9BN2O2/c1-7-8(2)16-12(15-7)10-4-3-5-11-9(10)6-13-14-11/h3-6H,1-2H2,(H,13,14) |
| InChIKey | YVRDKKQDKIEPKT-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.02 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|