About (Z)-N-methyl-N'-[1-(1H-pyrrol-2-yl)ethenyl]ethene-1,2-diamine
(Z)-N-methyl-N'-[1-(1H-pyrrol-2-yl)ethenyl]ethene-1,2-diamine (PubChem CID 89221455) has the molecular formula C9H13N3
and a molecular weight of 163.22 g/mol. Its IUPAC name is (Z)-N-methyl-N'-[1-(1H-pyrrol-2-yl)ethenyl]ethene-1,2-diamine.
Molecular Properties
| Compound Name | (Z)-N-methyl-N'-[1-(1H-pyrrol-2-yl)ethenyl]ethene-1,2-diamine |
| PubChem CID | 89221455 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | (Z)-N-methyl-N'-[1-(1H-pyrrol-2-yl)ethenyl]ethene-1,2-diamine |
| SMILES | C=C(N/C=C\NC)c1ccc[nH]1 |
| InChI | InChI=1S/C9H13N3/c1-8(11-7-6-10-2)9-4-3-5-12-9/h3-7,10-12H,1H2,2H3/b7-6- |
| InChIKey | QUFFHZHNJVIOIX-SREVYHEPSA-N |
| XLogP | 1.27 |
| TPSA | 39.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (Z)-N-methyl-N'-[1-(1H-pyrrol-2-yl)ethenyl]ethene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-methyl-N'-[1-(1H-pyrrol-2-yl)ethenyl]ethene-1,2-diamine?
The IUPAC name of (Z)-N-methyl-N'-[1-(1H-pyrrol-2-yl)ethenyl]ethene-1,2-diamine (CID 89221455) is (Z)-N-methyl-N'-[1-(1H-pyrrol-2-yl)ethenyl]ethene-1,2-diamine.
What is the SMILES notation for (Z)-N-methyl-N'-[1-(1H-pyrrol-2-yl)ethenyl]ethene-1,2-diamine?
The canonical SMILES for (Z)-N-methyl-N'-[1-(1H-pyrrol-2-yl)ethenyl]ethene-1,2-diamine is C=C(N/C=C\NC)c1ccc[nH]1.
What is the InChIKey of (Z)-N-methyl-N'-[1-(1H-pyrrol-2-yl)ethenyl]ethene-1,2-diamine?
The InChIKey is QUFFHZHNJVIOIX-SREVYHEPSA-N. The full InChI is InChI=1S/C9H13N3/c1-8(11-7-6-10-2)9-4-3-5-12-9/h3-7,10-12H,1H2,2H3/b7-6-.
What are the key properties of (Z)-N-methyl-N'-[1-(1H-pyrrol-2-yl)ethenyl]ethene-1,2-diamine?
(Z)-N-methyl-N'-[1-(1H-pyrrol-2-yl)ethenyl]ethene-1,2-diamine has a molecular weight of 163.22 g/mol, XLogP of 1.27, 4 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-methyl-N'-[1-(1H-pyrrol-2-yl)ethenyl]ethene-1,2-diamine is sourced from PubChem (CID 89221455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).