C21H20N2O3S2 — CID 89221499
(2E)-5-[6-(hydroxymethyl)-3-methyl-2H-1,3-benzothiazol-2-yl]-3-methyl-2-phenacylidene-1,3-thiazolidin-4-one (PubChem CID 89221499) has the molecular formula C21H20N2O3S2 and a molecular weight of 412.54 g/mol. Its IUPAC name is (2E)-5-[6-(hydroxymethyl)-3-methyl-2H-1,3-benzothiazol-2-yl]-3-methyl-2-phenacylidene-1,3-thiazolidin-4-one.
| Compound Name | (2E)-5-[6-(hydroxymethyl)-3-methyl-2H-1,3-benzothiazol-2-yl]-3-methyl-2-phenacylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 89221499 |
| Molecular Formula | C21H20N2O3S2 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | (2E)-5-[6-(hydroxymethyl)-3-methyl-2H-1,3-benzothiazol-2-yl]-3-methyl-2-phenacylidene-1,3-thiazolidin-4-one |
| SMILES | CN1C(=O)C(C2Sc3cc(CO)ccc3N2C)S/C1=C/C(=O)c1ccccc1 |
| InChI | InChI=1S/C21H20N2O3S2/c1-22-15-9-8-13(12-24)10-17(15)27-21(22)19-20(26)23(2)18(28-19)11-16(25)14-6-4-3-5-7-14/h3-11,19,21,24H,12H2,1-2H3/b18-11+ |
| InChIKey | IPLUDKZRRRHNEN-WOJGMQOQSA-N |
| XLogP | 3.35 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|