C9H21NO3 — CID 89221609
(2S,3S,4R,5R)-5-methyl-1-(methylamino)heptane-2,3,4-triol (PubChem CID 89221609) has the molecular formula C9H21NO3 and a molecular weight of 191.27 g/mol. Its IUPAC name is (2S,3S,4R,5R)-5-methyl-1-(methylamino)heptane-2,3,4-triol.
| Compound Name | (2S,3S,4R,5R)-5-methyl-1-(methylamino)heptane-2,3,4-triol |
|---|---|
| PubChem CID | 89221609 |
| Molecular Formula | C9H21NO3 |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.15 |
| IUPAC Name | (2S,3S,4R,5R)-5-methyl-1-(methylamino)heptane-2,3,4-triol |
| SMILES | CC[C@@H](C)[C@@H](O)[C@H](O)[C@@H](O)CNC |
| InChI | InChI=1S/C9H21NO3/c1-4-6(2)8(12)9(13)7(11)5-10-3/h6-13H,4-5H2,1-3H3/t6-,7+,8-,9-/m1/s1 |
| InChIKey | OCDYUHKCOQYQIG-BZNPZCIMSA-N |
| XLogP | -0.67 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |